Difference between revisions of "CHC T00008561001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
(Created page with "Category:Gene == Gene CHC_T00008561001 == * left end position: ** 7670 * transcription direction: ** POSITIVE * right end position: ** 8743 * centisome position: ** 3.7773...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Gene CHC_T00008561001 ==
* smiles:
+
* left end position:
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 7670
* inchi key:
+
* transcription direction:
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
+
** POSITIVE
* common name:
+
* right end position:
** β-ketovaleryl-CoA
+
** 8743
* molecular weight:
+
* centisome position:
** 861.604    
+
** 3.7773576    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[IGPSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-original_genome]]
* [[RXN-12561]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=7670}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=8743}}
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
+
{{#set: centisome position=3.7773576    }}
{{#set: common name=β-ketovaleryl-CoA}}
+
{{#set: reaction associated=IGPSYN-RXN}}
{{#set: molecular weight=861.604    }}
+
{{#set: pathway associated=TRPSYN-PWY}}
{{#set: consumed or produced by=RXN-12561}}
+

Latest revision as of 15:30, 23 May 2018

Gene CHC_T00008561001

  • left end position:
    • 7670
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8743
  • centisome position:
    • 3.7773576
  • Synonym(s):

Reactions associated

Pathways associated

External links