Difference between revisions of "Lysidine-tRNA-Ile2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-824-CHOLESTADIENOL 4-METHYL-824-CHOLESTADIENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lysidine-tRNA-Ile2 Lysidine-tRNA-Ile2] == * common name: ** a lysidine34 in tRNAIle2 * Synonym(...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-METHYL-824-CHOLESTADIENOL 4-METHYL-824-CHOLESTADIENOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lysidine-tRNA-Ile2 Lysidine-tRNA-Ile2] ==
−
* smiles:
+
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
−
* inchi key:
+
−
** InChIKey=FOUJWBXBKVVHCJ-YIJYGBTNSA-N
+
 
* common name:
 
* common name:
−
** 4α-methyl-zymosterol
+
** a lysidine34 in tRNAIle2
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4α-methyl-5α-cholesta-8,24-dien-3β-ol
+
** a [tRNAIle2]-N6-(4-amino-1-β-D-ribofuranosylpyrimidin-2-ylidene)-L-lysine34
−
** 4-methyl-8,24-cholestadienol
+
** a [tRNAIle2]-lysidine34
−
** 4-α-methyl-5α-cholesta-8,24-dien-3β-ol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13709]]
 
−
* [[RXN66-315]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-1961]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a lysidine34 in tRNAIle2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05103 C05103]
+
{{#set: common name=a [tRNAIle2]-N6-(4-amino-1-β-D-ribofuranosylpyrimidin-2-ylidene)-L-lysine34|a [tRNAIle2]-lysidine34}}
−
* CHEBI:
+
{{#set: produced by=RXN-1961}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1949 1949]
+
−
* METABOLIGHTS : MTBLC1949
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22212495 22212495]
+
−
* HMDB : HMDB01217
+
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=FOUJWBXBKVVHCJ-YIJYGBTNSA-N}}
+
−
{{#set: common name=4α-methyl-zymosterol}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: common name=4α-methyl-5α-cholesta-8,24-dien-3β-ol|4-methyl-8,24-cholestadienol|4-α-methyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: consumed by=RXN-13709|RXN66-315}}
+

Latest revision as of 15:30, 23 May 2018

Metabolite Lysidine-tRNA-Ile2

  • common name:
    • a lysidine34 in tRNAIle2
  • Synonym(s):
    • a [tRNAIle2]-N6-(4-amino-1-β-D-ribofuranosylpyrimidin-2-ylidene)-L-lysine34
    • a [tRNAIle2]-lysidine34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • "a [tRNAIle2]-N6-(4-amino-1-β-D-ribofuranosylpyrimidin-2-ylidene)-L-lysine34" cannot be used as a page name in this wiki.
  • "a [tRNAIle2]-lysidine34" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Lysidine-tRNA-Ile2&oldid=14522"