Difference between revisions of "CHC T00009368001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene CHC_T00009368001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-12454 ** Source: orthology-galdieria.sulphuraria * Reaction:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00009368001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RXN-12454]] |
| − | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
| − | == | + | * Reaction: [[RXN-12455]] |
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | * Reaction: [[RXN0-1281]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-12454|RXN-12455|RXN0-1281}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 15:31, 23 May 2018
Gene CHC_T00009368001_1
- Synonym(s):
Reactions associated
- Reaction: RXN-12454
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-12455
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN0-1281
- Source: orthology-ectocarpus_siliculosus
