Difference between revisions of "PWY-5437"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5437 PWY-5437] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5437 PWY-5437] ==
* smiles:
+
* taxonomic range:
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
+
 
* common name:
 
* common name:
** 5-dehydroavenasterol
+
** L-threonine degradation I
* molecular weight:
+
** 410.682   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[RXN-4209]]
+
* [[RXN-15122]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00007475001_1]]
 +
*** [[CHC_T00005128001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=KETOBUTFORMLY-RXN KETOBUTFORMLY-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PROPKIN-RXN PROPKIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PTAALT-RXN PTAALT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15121 RXN-15121]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15123 RXN-15123]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263331 44263331]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5437 PWY-5437]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
+
{{#set: common name=L-threonine degradation I}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
+
{{#set: total reaction=6}}
* HMDB : HMDB06852
+
{{#set: completion rate=17.0}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
+
{{#set: common name=5-dehydroavenasterol}}
+
{{#set: molecular weight=410.682    }}
+
{{#set: produced by=RXN-4209}}
+

Revision as of 15:32, 23 May 2018

Pathway PWY-5437

  • taxonomic range:
  • common name:
    • L-threonine degradation I
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links