Difference between revisions of "PROPANOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPANOL PROPANOL] == * smiles: ** CCCO * inchi key: ** InChIKey=BDERNNFJNOPAEC-UHFFFAOYSA-N *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPANOL PROPANOL] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCO |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BDERNNFJNOPAEC-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** propan-1-ol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 60.096 |
* Synonym(s): | * Synonym(s): | ||
− | ** 1- | + | ** osmosol extra |
− | ** | + | ** optal |
+ | ** 1-hydroxypropane | ||
+ | ** ethylcarbinol | ||
+ | ** 1-propanol | ||
+ | ** n-propanol | ||
+ | ** propanol | ||
+ | ** propylalcohol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-13198]] |
== External links == | == External links == | ||
+ | * CAS : 71-23-8 | ||
+ | * DRUGBANK : DB03175 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1031 1031] |
+ | * HMDB : HMDB00820 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05979 C05979] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1004.html 1004] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28831 28831] |
− | + | {{#set: smiles=CCCO}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=BDERNNFJNOPAEC-UHFFFAOYSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=propan-1-ol}} |
− | {{#set: common name= | + | {{#set: molecular weight=60.096 }} |
− | {{#set: molecular weight= | + | {{#set: common name=osmosol extra|optal|1-hydroxypropane|ethylcarbinol|1-propanol|n-propanol|propanol|propylalcohol}} |
− | {{#set: common name=1- | + | {{#set: reversible reaction associated=RXN-13198}} |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 15:34, 23 May 2018
Contents
Metabolite PROPANOL
- smiles:
- CCCO
- inchi key:
- InChIKey=BDERNNFJNOPAEC-UHFFFAOYSA-N
- common name:
- propan-1-ol
- molecular weight:
- 60.096
- Synonym(s):
- osmosol extra
- optal
- 1-hydroxypropane
- ethylcarbinol
- 1-propanol
- n-propanol
- propanol
- propylalcohol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71-23-8
- DRUGBANK : DB03175
- PUBCHEM:
- HMDB : HMDB00820
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: