Difference between revisions of "RXN0-5507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5507 RXN0-5507] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5507 RXN0-5507] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
** [http://enzyme.expasy.org/EC/4.1.2.50 EC-4.1.2.50]
−
* common name:
+
−
** cycloartenol
+
−
* molecular weight:
+
−
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 9β,19-cyclo-24-lanosten-3β-ol
 
−
** cycloart-24(25)-enol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
** 1 [[WATER]][c] '''+''' 1 [[DIHYDRONEOPTERIN-P3]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[P3I]][c] '''+''' 1 [[CPD0-1699]][c] '''+''' 1 [[ACETALD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 7,8-dihydroneopterin 3'-triphosphate[c] '''=>''' 2 H+[c] '''+''' 1 PPPi[c] '''+''' 1 6-carboxy-5,6,7,8-tetrahydropterin[c] '''+''' 1 acetaldehyde[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6703]], preQ0 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6703 PWY-6703]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* CAS : 469-38-5
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27966 27966]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R09959 R09959]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-4.1.2.50}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
{{#set: in pathway=PWY-6703}}
−
* HMDB : HMDB36591
+
{{#set: reconstruction category=gap-filling}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: reconstruction tool=meneco}}
−
{{#set: common name=cycloartenol}}
+
{{#set: reconstruction comment=added for gapfilling}}
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
−
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Latest revision as of 16:35, 23 May 2018

Reaction RXN0-5507

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 7,8-dihydroneopterin 3'-triphosphate[c] => 2 H+[c] + 1 PPPi[c] + 1 6-carboxy-5,6,7,8-tetrahydropterin[c] + 1 acetaldehyde[c]

Genes associated with this reaction

Pathways

  • PWY-6703, preQ0 biosynthesis: PWY-6703
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN0-5507&oldid=14760"