Difference between revisions of "CHC T00005154001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Gene == Gene CHC_T00005154001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.1.4.11-RXN ** Source: orthology-ectocarpus_siliculosus * Reacti...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00005154001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.1.4.11-RXN]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | == | + | * Reaction: [[RXN-13334]] |
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN-16261]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6367]] | ||
+ | * [[PWY-6351]] | ||
+ | * [[PWY-7039]] | ||
+ | * [[LIPASYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.1.4.11-RXN|RXN-13334|RXN-16261}} | |
− | + | {{#set: pathway associated=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 15:35, 23 May 2018
Gene CHC_T00005154001_1
- Synonym(s):
Reactions associated
- Reaction: 3.1.4.11-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-13334
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-16261
- Source: orthology-ectocarpus_siliculosus