Difference between revisions of "RXN-13482"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.1...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.1.3.3 EC-2.1.3.3] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[CARBAMOYL-P]][c] '''+''' 1 [[L-ORNITHINE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[L-CITRULLINE]][c] '''+''' 1 [[Pi]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 carbamoyl phosphate[c] '''+''' 1 L-ornithine[c] '''<=>''' 1 H+[c] '''+''' 1 L-citrulline[c] '''+''' 1 phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00005123001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-2.1.3.3}} | |
| − | + | {{#set: gene associated=CHC_T00005123001_1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:41, 23 May 2018
Contents
Reaction RXN-13482
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CARBAMOYL-P[c] + 1 L-ORNITHINE[c] <=> 1 PROTON[c] + 1 L-CITRULLINE[c] + 1 Pi[c]
- With common name(s):
- 1 carbamoyl phosphate[c] + 1 L-ornithine[c] <=> 1 H+[c] + 1 L-citrulline[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00005123001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
