Difference between revisions of "CPD-18777"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FE+2 FE+2] == * smiles: ** [Fe++] * inchi key: ** InChIKey=CWYNVVGOOAEACU-UHFFFAOYSA-N * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) * common name: ** my...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18777 CPD-18777] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** mycosporine glycine |
| + | * inchi key: | ||
| + | ** InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 244.224 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17368]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[extended_RXN-17371]] |
| + | * [[RXN-17371]] | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)}} | |
| − | + | {{#set: common name=mycosporine glycine}} | |
| − | + | {{#set: inchi key=InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M}} | |
| − | + | {{#set: molecular weight=244.224 }} | |
| − | + | {{#set: produced by=RXN-17368}} | |
| − | + | {{#set: reversible reaction associated=extended_RXN-17371|RXN-17371}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | + | ||
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:41, 23 May 2018
Contents
Metabolite CPD-18777
- smiles:
- COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)
- common name:
- mycosporine glycine
- inchi key:
- InChIKey=XZQILKYKJYHEHD-JTQLQIEISA-M
- molecular weight:
- 244.224
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=O)1)" cannot be used as a page name in this wiki.
