Difference between revisions of "CHC T00005083001 1"

Latest revision as of 16:42, 23 May 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+== Gene CHC_T00005083001_1 ==
-* smiles:
-** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
-* common name:
-** (2E,7Z)-tetradecenoyl-CoA
-* molecular weight:
-** 969.83
 * Synonym(s):
-** 14:2-&Delta;2,&Delta;7-CoA
-** 2-trans,7-cis-tetradecenoyl-CoA
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-17793]]
+* Reaction: [[RXN-1884]]
-== Reaction(s) known to produce the compound ==
+** Source: [[orthology-ectocarpus_siliculosus]]
-* [[RXN-17792]]
+== Pathways associated ==
-== Reaction(s) of unknown directionality ==
+* [[PWY-882]]
 == External links  ==
-{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: reaction associated=RXN-1884}}
-{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+{{#set: pathway associated=PWY-882}}
-{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
-{{#set: molecular weight=969.83    }}
-{{#set: common name=14:2-&Delta;2,&Delta;7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
-{{#set: consumed by=RXN-17793}}
-{{#set: produced by=RXN-17792}}