Difference between revisions of "CHC T00008966001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] == * smiles: ** C([O-])(=O)CC1(C=CC(=C(C=1)O)O) * inchi key: ** InChIKey=CFFZD...") |
(Created page with "Category:Gene == Gene CHC_T00010146001 == * left end position: ** 423689 * transcription direction: ** NEGATIVE * right end position: ** 424459 * centisome position: ** 69...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00010146001 == |
− | * | + | * left end position: |
− | ** | + | ** 423689 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 424459 |
− | * | + | * centisome position: |
− | ** | + | ** 69.076836 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ATPSYN-RXN]] | |
− | * [[ | + | ** original_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=423689}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=424459}} | |
− | + | {{#set: centisome position=69.076836 }} | |
− | + | {{#set: reaction associated=ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 10:46, 18 January 2018
Gene CHC_T00010146001
- left end position:
- 423689
- transcription direction:
- NEGATIVE
- right end position:
- 424459
- centisome position:
- 69.076836
- Synonym(s):
Reactions associated
- ATPSYN-RXN
- original_genome
- automated-name-match
- original_genome