Difference between revisions of "RXN-12789"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12789 RXN-12789] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12789 RXN-12789] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** chlorophyll a
+
** [http://enzyme.expasy.org/EC/1.1.1.145 EC-1.1.1.145]
−
* molecular weight:
+
−
** 892.495   
+
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyll a (phytol)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17428]]
+
** 1 [[CPD-4143]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-13793]][c] '''+''' 1 [[NADH]][c]
−
* [[RXN-7666]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 sitosterol[c] '''+''' 1 NAD+[c] '''=>''' 1 H+[c] '''+''' 1 3-oxo-24-ethyl-cholest-5-ene[c] '''+''' 1 NADH[c]
−
* [[RXN1F-66]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00007359001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00003646001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6948]], sitosterol degradation to androstenedione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6948 PWY-6948]
 +
** '''2''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 479-61-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.145}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
+
{{#set: gene associated=CHC_T00007359001_1|CHC_T00003646001_1}}
−
* KNAPSACK : C00001528
+
{{#set: in pathway=PWY-6948}}
−
* HMDB : HMDB38578
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyll a}}
+
−
{{#set: molecular weight=892.495    }}
+
−
{{#set: common name=chlorophyll a (phytol)}}
+
−
{{#set: produced by=RXN-17428|RXN-7666}}
+
−
{{#set: consumed or produced by=RXN1F-66}}
+

Revision as of 16:45, 23 May 2018

Reaction RXN-12789

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 sitosterol[c] + 1 NAD+[c] => 1 H+[c] + 1 3-oxo-24-ethyl-cholest-5-ene[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6948, sitosterol degradation to androstenedione: PWY-6948
    • 2 reactions found over 18 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12789&oldid=15197"