Difference between revisions of "PWY0-541"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-541 PWY0-541] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-541 PWY0-541] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** cyclopropane fatty acid (CFA) biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | + | * [[2.1.1.79-RXN]] | |
| − | * [[ | + | ** 4 associated gene(s): |
| − | == Reaction(s) | + | *** [[CHC_T00009019001]] |
| + | *** [[CHC_T00005488001_1]] | ||
| + | *** [[CHC_T00006042001_1]] | ||
| + | *** [[CHC_T00003092001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-541 PWY0-541] |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | + | {{#set: common name=cyclopropane fatty acid (CFA) biosynthesis}} | |
| − | {{#set: common name= | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=1}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:45, 23 May 2018
Pathway PWY0-541
- taxonomic range:
- common name:
- cyclopropane fatty acid (CFA) biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- 2.1.1.79-RXN
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
