Difference between revisions of "FUM"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FUM FUM] == * smiles: ** C(C([O-])=O)=CC(=O)[O-] * inchi key: ** InChIKey=VZCYOOQTPOCHFL-OWOJBT...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FUM FUM] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C(C([O-])=O)=CC(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-L |
* common name: | * common name: | ||
| − | ** | + | ** fumarate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 114.057 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** fum |
| − | ** | + | ** fumaric acid |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15378]] |
| + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | ||
| + | * [[FUMARYLACETOACETASE-RXN]] | ||
| + | * [[RXN-14971]] | ||
| + | * [[RXN-22]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ARGSUCCINLYA-RXN]] | ||
| + | * [[FUMHYDR-RXN]] | ||
| + | * [[AICARSYN-RXN]] | ||
| + | * [[AMPSYN-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 110-17-8 |
| + | * METABOLIGHTS : MTBLC29806 | ||
| + | * DRUGBANK : DB01677 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460307 5460307] |
| − | * HMDB : | + | * KNAPSACK : C00001183 |
| + | * HMDB : HMDB00134 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00122 C00122] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4573886.html 4573886] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29806 29806] |
| − | * BIGG : | + | * BIGG : fum |
| − | {{#set: smiles=C | + | {{#set: smiles=C(C([O-])=O)=CC(=O)[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-L}} |
| − | {{#set: common name= | + | {{#set: common name=fumarate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=114.057 }} |
| − | {{#set: common name= | + | {{#set: common name=fum|fumaric acid}} |
| − | {{#set: | + | {{#set: produced by=RXN-15378|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN|FUMARYLACETOACETASE-RXN|RXN-14971|RXN-22}} |
| − | {{#set: | + | {{#set: reversible reaction associated=ARGSUCCINLYA-RXN|FUMHYDR-RXN|AICARSYN-RXN|AMPSYN-RXN}} |
Revision as of 16:46, 23 May 2018
Contents
Metabolite FUM
- smiles:
- C(C([O-])=O)=CC(=O)[O-]
- inchi key:
- InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-L
- common name:
- fumarate
- molecular weight:
- 114.057
- Synonym(s):
- fum
- fumaric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 110-17-8
- METABOLIGHTS : MTBLC29806
- DRUGBANK : DB01677
- PUBCHEM:
- KNAPSACK : C00001183
- HMDB : HMDB00134
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : fum
"C(C([O-])=O)=CC(=O)[O-" cannot be used as a page name in this wiki.
