Difference between revisions of "METHACRYLYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeDeadEnd_SUC ExchangeDeadEnd_SUC] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reactio...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C |
+ | * inchi key: | ||
+ | ** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J | ||
+ | * common name: | ||
+ | ** methylacrylyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 831.577 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** methacrylyl-CoA | ||
+ | ** 2-methylprop-2-enoyl-CoA | ||
+ | ** methacrylyl-coenzyme A | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[METHYLACYLYLCOA-HYDROXY-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 6008-91-9 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460] | ||
+ | * HMDB : HMDB01011 | ||
+ | {{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}} | ||
+ | {{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}} | ||
+ | {{#set: common name=methylacrylyl-CoA}} | ||
+ | {{#set: molecular weight=831.577 }} | ||
+ | {{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}} | ||
+ | {{#set: reversible reaction associated=METHYLACYLYLCOA-HYDROXY-RXN}} |
Revision as of 15:47, 23 May 2018
Contents
Metabolite METHACRYLYL-COA
- smiles:
- C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
- inchi key:
- InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
- common name:
- methylacrylyl-CoA
- molecular weight:
- 831.577
- Synonym(s):
- methacrylyl-CoA
- 2-methylprop-2-enoyl-CoA
- methacrylyl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C" cannot be used as a page name in this wiki.