Difference between revisions of "CPD-14928"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-36 TRANS-RXN1HP7-36] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-36 TRANS-RXN1HP7-36] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 +
* inchi key:
 +
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
 
* common name:
 
* common name:
** TRANS-RXN1HP7-36
+
** phytenoyl-CoA
 +
* molecular weight:
 +
** 1056.006   
 
* Synonym(s):
 
* Synonym(s):
 +
** E-phytenoyl-CoA
 +
** trans-phytenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN66-482]]
** 1.0 [[CPD-5]][e] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[CPD-5]][c] '''+''' 1.0 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN66-480]]
** 1.0 a [FeS] iron-sulfur cluster[e] '''+''' 1.0 H2O[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 a [FeS] iron-sulfur cluster[c] '''+''' 1.0 ADP[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00006881001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=TRANS-RXN1HP7-36}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
{{#set: gene associated=CHC_T00006881001_1}}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=phytenoyl-CoA}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=1056.006    }}
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
 +
{{#set: consumed by=RXN66-482}}
 +
{{#set: produced by=RXN66-480}}

Revision as of 15:48, 23 May 2018

Metabolite CPD-14928

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
  • common name:
    • phytenoyl-CoA
  • molecular weight:
    • 1056.006
  • Synonym(s):
    • E-phytenoyl-CoA
    • trans-phytenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.