Difference between revisions of "CHC T00008374001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] == * smiles: ** C1(NC(N)=O)(NC(=O)NC(=O)1) * inchi key: ** InChIKey=PO...") |
(Created page with "Category:Gene == Gene CHC_T00008374001 == * left end position: ** 140662 * transcription direction: ** POSITIVE * right end position: ** 141714 * centisome position: ** 48...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008374001 == |
− | * | + | * left end position: |
− | ** | + | ** 140662 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 141714 |
− | * | + | * centisome position: |
− | ** | + | ** 48.009804 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]] |
− | == | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
+ | * [[PWY-5129]] | ||
+ | * [[PWY3DJ-12]] | ||
+ | * [[SPHINGOLIPID-SYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=140662}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=141714}} | |
− | + | {{#set: centisome position=48.009804 }} | |
− | + | {{#set: reaction associated=3-DEHYDROSPHINGANINE-REDUCTASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5129|PWY3DJ-12|SPHINGOLIPID-SYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:49, 23 May 2018
Gene CHC_T00008374001
- left end position:
- 140662
- transcription direction:
- POSITIVE
- right end position:
- 141714
- centisome position:
- 48.009804
- Synonym(s):
Reactions associated
- Reaction: 3-DEHYDROSPHINGANINE-REDUCTASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome