Difference between revisions of "FeS-Cluster-Chaperones-ATP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] == * common name: ** an [Fe-S cluster bi...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] ==
* smiles:
+
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
* inchi key:
+
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
+
 
* common name:
 
* common name:
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
+
** an [Fe-S cluster biosynthesis chaperone]-ATP
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14389]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16558]]
+
* [[RXN-14391]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [Fe-S cluster biosynthesis chaperone]-ATP}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
+
{{#set: consumed by=RXN-14389}}
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: produced by=RXN-14391}}
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
+
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
+
{{#set: molecular weight=1015.898    }}
+
{{#set: produced by=RXN-16558}}
+

Latest revision as of 15:55, 23 May 2018

Metabolite FeS-Cluster-Chaperones-ATP

  • common name:
    • an [Fe-S cluster biosynthesis chaperone]-ATP
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [Fe-S cluster biosynthesis chaperone]-ATP" cannot be used as a page name in this wiki.