Difference between revisions of "CPD-17813"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00005531001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == |
+ | * smiles: | ||
+ | ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J | ||
+ | * common name: | ||
+ | ** (2E,11Z)-hexadec-2,11-dienoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 997.883 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-16558]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958] |
+ | {{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | ||
+ | {{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}} | ||
+ | {{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}} | ||
+ | {{#set: molecular weight=997.883 }} | ||
+ | {{#set: consumed by=RXN-16558}} |
Revision as of 16:55, 23 May 2018
Contents
Metabolite CPD-17813
- smiles:
- CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- inchi key:
- InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
- common name:
- (2E,11Z)-hexadec-2,11-dienoyl-CoA
- molecular weight:
- 997.883
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.