Difference between revisions of "CPD-7526"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643] == * direction: ** LEFT-TO-RIGHT * common name: ** branched-chain alpha-keto aci...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == * smiles: ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7526 CPD-7526] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 9,9'-di-cis-ζ-carotene |
− | * | + | * molecular weight: |
− | ** | + | ** 540.914 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11356]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11354]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-12242]] | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440490 6440490] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4944750.html 4944750] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48716 48716] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15857 C15857] |
+ | * HMDB : HMDB03063 | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N}} | ||
+ | {{#set: common name=9,9'-di-cis-ζ-carotene}} | ||
+ | {{#set: molecular weight=540.914 }} | ||
+ | {{#set: consumed by=RXN-11356}} | ||
+ | {{#set: produced by=RXN-11354}} | ||
+ | {{#set: reversible reaction associated=RXN-12242}} |
Revision as of 15:56, 23 May 2018
Contents
Metabolite CPD-7526
- smiles:
- CC(=CCCC(=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
- inchi key:
- InChIKey=BIWLELKAFXRPDE-ZURBLSRNSA-N
- common name:
- 9,9'-di-cis-ζ-carotene
- molecular weight:
- 540.914
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links