Difference between revisions of "CPD-14443"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00004649001_1 == * Synonym(s): == Reactions associated == * 2.4.1.101-RXN ** pantograph-galdieria.sulphuraria == Pathways associate...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00004649001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
 +
* smiles:
 +
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
 +
* inchi key:
 +
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
 +
* common name:
 +
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
 +
* molecular weight:
 +
** 185.136   
 
* Synonym(s):
 
* Synonym(s):
 +
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.4.1.101-RXN]]
+
* [[RXN-14014]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[DIHYDRODIPICSYN-RXN]]
* [[PWY-7426]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=2.4.1.101-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7426}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
 +
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
 +
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
 +
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
 +
{{#set: molecular weight=185.136    }}
 +
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
 +
{{#set: consumed by=RXN-14014}}
 +
{{#set: produced by=DIHYDRODIPICSYN-RXN}}

Revision as of 15:56, 23 May 2018

Metabolite CPD-14443

  • smiles:
    • C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
  • inchi key:
    • InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
  • common name:
    • (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
  • molecular weight:
    • 185.136
  • Synonym(s):
    • (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)" cannot be used as a page name in this wiki.