Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9247 CPD-9247] == * smiles: ** CCCCCCC=CCCCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=UWHZIFQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L |
* common name: | * common name: | ||
− | ** | + | ** α,ω-9Z-octadecenedioate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 310.433 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α,ω-9Z-octadecenedioic acid |
− | ** | + | ** 1,18-9Z-octadecenedioic acid |
− | + | ** octadecenedioate | |
− | ** | + | ** 18-carboxyl oleate |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16418]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642] |
− | + | {{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}} | |
− | + | {{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}} | |
− | + | {{#set: common name=α,ω-9Z-octadecenedioate}} | |
− | + | {{#set: molecular weight=310.433 }} | |
− | {{#set: smiles= | + | {{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-16418}} |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + |
Revision as of 15:57, 23 May 2018
Contents
Metabolite OCTADEC-9-ENE-118-DIOIC-ACID
- smiles:
- C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
- inchi key:
- InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
- common name:
- α,ω-9Z-octadecenedioate
- molecular weight:
- 310.433
- Synonym(s):
- α,ω-9Z-octadecenedioic acid
- 1,18-9Z-octadecenedioic acid
- octadecenedioate
- 18-carboxyl oleate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.