Difference between revisions of "PWY-7117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4479 TAX-4479] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** C4 photosynthetic carbon assimilation cycle, PEPCK type |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** C4 photosynthesis, PEPCK type |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''7''' reactions found over '''10''' reactions in the full pathway |
− | + | * [[ASPAMINOTRANS-RXN]] | |
− | * [[RXN- | + | ** 8 associated gene(s): |
− | == Reaction(s) | + | *** [[CHC_T00010017001]] |
+ | *** [[CHC_T00005085001_1]] | ||
+ | *** [[CHC_T00008432001]] | ||
+ | *** [[CHC_T00006498001_1]] | ||
+ | *** [[CHC_T00009477001]] | ||
+ | *** [[CHC_T00003344001_1]] | ||
+ | *** [[CHC_T00009477001_1]] | ||
+ | *** [[CHC_T00010197001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[MALATE-DEHYDROGENASE-NADP+-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008878001]] | ||
+ | *** [[CHC_T00009563001]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-original_genome]] | ||
+ | * [[MALIC-NADP-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008878001_1]] | ||
+ | *** [[CHC_T00009563001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PEPCARBOX-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00008437001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008789001_1]] | ||
+ | *** [[CHC_T00008992001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[RXN-13697]] | ||
+ | ** 8 associated gene(s): | ||
+ | *** [[CHC_T00006498001_1]] | ||
+ | *** [[CHC_T00003344001_1]] | ||
+ | *** [[CHC_T00008432001]] | ||
+ | *** [[CHC_T00010197001]] | ||
+ | *** [[CHC_T00010017001]] | ||
+ | *** [[CHC_T00005085001_1]] | ||
+ | *** [[CHC_T00009477001_1]] | ||
+ | *** [[CHC_T00009477001]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[RXN0-5224]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00010321001_1]] | ||
+ | *** [[CHC_T00010062001_1]] | ||
+ | *** [[CHC_T00002086001_1]] | ||
+ | *** [[CHC_T00010311001_1]] | ||
+ | *** [[CHC_T00007098001_1]] | ||
+ | *** [[CHC_T00010321001]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-AMINOTRANSFERASE-RXN ALANINE-AMINOTRANSFERASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOXYKIN-RXN PEPCARBOXYKIN-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3398}} | |
− | + | {{#set: taxonomic range=TAX-4479}} | |
− | {{#set: | + | {{#set: common name=C4 photosynthetic carbon assimilation cycle, PEPCK type}} |
− | {{#set: | + | {{#set: common name=C4 photosynthesis, PEPCK type}} |
− | {{#set: common name= | + | {{#set: reaction found=7}} |
− | {{#set: | + | {{#set: total reaction=10}} |
− | {{#set: | + | {{#set: completion rate=70.0}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:00, 23 May 2018
Pathway PWY-7117
- taxonomic range:
- common name:
- C4 photosynthetic carbon assimilation cycle, PEPCK type
- Synonym(s):
- C4 photosynthesis, PEPCK type
Reaction(s) found
7 reactions found over 10 reactions in the full pathway
- ASPAMINOTRANS-RXN
- 8 associated gene(s):
- 4 reconstruction source(s) associated:
- MALATE-DEHYDROGENASE-NADP+-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- MALIC-NADP-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- PEPCARBOX-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-13697
- 8 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN0-5224
- 6 associated gene(s):
- 3 reconstruction source(s) associated: