Difference between revisions of "PMPOXI-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) * common name: ** 6...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PMPOXI-RXN PMPOXI-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PMPOXI-RXN PMPOXI-RXN] ==
−
* smiles:
+
* direction:
−
** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 6-carboxy-5,6,7,8-tetrahydropterin
+
** [http://enzyme.expasy.org/EC/1.4.3.5 EC-1.4.3.5]
−
* inchi key:
+
−
** InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
+
−
* molecular weight:
+
−
** 210.172   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6-carboxytetrahydropterin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-5507]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PYRIDOXAMINE-5P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 pyridoxamine 5'-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 pyridoxal 5'-phosphate[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008142001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00006254001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
 +
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123380 44123380]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15817 15817]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00277 R00277]
−
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}}
+
* UNIPROT:
−
{{#set: common name=6-carboxy-5,6,7,8-tetrahydropterin}}
+
** [http://www.uniprot.org/uniprot/P0AFI7 P0AFI7]
−
{{#set: inchi key=InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M}}
+
** [http://www.uniprot.org/uniprot/Q9JTZ1 Q9JTZ1]
−
{{#set: molecular weight=210.172    }}
+
** [http://www.uniprot.org/uniprot/P44909 P44909]
−
{{#set: common name=6-carboxytetrahydropterin}}
+
** [http://www.uniprot.org/uniprot/P38075 P38075]
−
{{#set: produced by=RXN0-5507}}
+
** [http://www.uniprot.org/uniprot/P74211 P74211]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: ec number=EC-1.4.3.5}}
 +
{{#set: gene associated=CHC_T00008142001_1|CHC_T00006254001_1}}
 +
{{#set: in pathway=PWY-7204|PLPSAL-PWY}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 16:02, 23 May 2018

Reaction PMPOXI-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7204, pyridoxal 5'-phosphate salvage II (plants): PWY-7204
    • 8 reactions found over 9 reactions in the full pathway
  • PLPSAL-PWY, pyridoxal 5'-phosphate salvage I: PLPSAL-PWY
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PMPOXI-RXN&oldid=15984"