Difference between revisions of "L-SELENOCYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * smiles: ** C([Se])C([N+])C([O-])=O * inchi key: ** InCh...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([Se])C([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-selenocysteine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 168.054 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** U |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SELENOCYSTEINE-LYASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12726]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05688 C05688] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57843 57843] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC57843 |
| − | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245418 25245418] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB03288 |
| − | {{#set: common name= | + | {{#set: smiles=C([Se])C([N+])C([O-])=O}} |
| − | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N}} |
| + | {{#set: common name=L-selenocysteine}} | ||
| + | {{#set: molecular weight=168.054 }} | ||
| + | {{#set: common name=U}} | ||
| + | {{#set: consumed by=SELENOCYSTEINE-LYASE-RXN}} | ||
| + | {{#set: produced by=RXN-12726}} | ||
Revision as of 16:02, 23 May 2018
Contents
Metabolite L-SELENOCYSTEINE
- smiles:
- C([Se])C([N+])C([O-])=O
- inchi key:
- InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
- common name:
- L-selenocysteine
- molecular weight:
- 168.054
- Synonym(s):
- U
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se])C([N+])C([O-])=O" cannot be used as a page name in this wiki.
