Difference between revisions of "CPD-18492"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15036 RXN-15036] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J |
| + | * common name: | ||
| + | ** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1102.034 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-17114]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17113]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193751 72193751] | |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76364 76364] |
| − | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J}} |
| − | {{#set: | + | {{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1102.034 }} |
| − | {{#set: | + | {{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17114}} |
| + | {{#set: produced by=RXN-17113}} | ||
Revision as of 16:03, 23 May 2018
Contents
Metabolite CPD-18492
- smiles:
- CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J
- common name:
- (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA
- molecular weight:
- 1102.034
- Synonym(s):
- (2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
