Difference between revisions of "CHC T00008412001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13937 CPD-13937] == * smiles: ** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(...")
(Created page with "Category:Gene == Gene CHC_T00008412001 == * left end position: ** 121767 * transcription direction: ** NEGATIVE * right end position: ** 123385 * centisome position: ** 24...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13937 CPD-13937] ==
+
== Gene CHC_T00008412001 ==
* smiles:
+
* left end position:
** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%13(OC(CO)C(O)C(O)C(OC%12(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%11(OC(CO)C(O)C(O)C(O)%11))))%12))%13))))O)
+
** 121767
* inchi key:
+
* transcription direction:
** InChIKey=WQOBEIJLPIXUTJ-RTIPJVFBSA-N
+
** NEGATIVE
* common name:
+
* right end position:
** Glc2Man9GlcNAc2
+
** 123385
* molecular weight:
+
* centisome position:
** 2207.966    
+
** 24.049082    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-4261]]
* [[3.2.1.106-RXN]]
+
** Source: [[annotation-original_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=121767}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657567 90657567]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%13(OC(CO)C(O)C(O)C(OC%12(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%11(OC(CO)C(O)C(O)C(O)%11))))%12))%13))))O)}}
+
{{#set: right end position=123385}}
{{#set: inchi key=InChIKey=WQOBEIJLPIXUTJ-RTIPJVFBSA-N}}
+
{{#set: centisome position=24.049082   }}
{{#set: common name=Glc2Man9GlcNAc2}}
+
{{#set: reaction associated=RXN0-4261}}
{{#set: molecular weight=2207.966   }}
+
{{#set: produced by=3.2.1.106-RXN}}
+

Latest revision as of 16:04, 23 May 2018

Gene CHC_T00008412001

  • left end position:
    • 121767
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 123385
  • centisome position:
    • 24.049082
  • Synonym(s):

Reactions associated

Pathways associated

External links