Difference between revisions of "CPD-19220"

Revision as of 16:05, 23 May 2018

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene CHC_1145 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] ==
-* left end position:
+* smiles:
-** 175326
+** C(O)C1(O)(CC(=O)C(O)=C(O)C1)
-* transcription direction:
-** NEGATIVE
-* right end position:
-** 175676
 * common name:
-** ftrB
+** (S)-demethyl-4-deoxygadusol
-* centisome position:
+* inchi key:
-** 97.35682
+** InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N
+* molecular weight:
+** 174.153
 * Synonym(s):
+** (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[RXN-9944]]
+* [[RXN-17896]]
-** original_genome
+== Reaction(s) known to produce the compound ==
-***automated-name-match
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
+* [[RXN-17895]]
 == External links  ==
-{{#set: left end position=175326}}
+{{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}}
-{{#set: transcription direction=NEGATIVE}}
+{{#set: common name=(S)-demethyl-4-deoxygadusol}}
-{{#set: right end position=175676}}
+{{#set: inchi key=InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N}}
-{{#set: common name=ftrB}}
+{{#set: molecular weight=174.153    }}
-{{#set: centisome position=97.35682    }}
+{{#set: common name=(5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}}
-{{#set: reaction associated=RXN-9944}}
+{{#set: consumed by=RXN-17896}}
+{{#set: reversible reaction associated=RXN-17895}}