Difference between revisions of "CPD-513"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008655001 == * left end position: ** 103829 * transcription direction: ** POSITIVE * right end position: ** 107458 * centisome position: ** 31...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-513 CPD-513] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-513 CPD-513] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 3-hydroxy-3-phenylpropanoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 911.663 |
* Synonym(s): | * Synonym(s): | ||
| + | ** hydroxycinnamoyl-CoA (ambiguous) | ||
| + | ** β-hydroxyphenyl-propionyl-CoA | ||
| + | ** 3-hydroxy-3-phenylpropionyl-coenzyme A | ||
| + | ** 3-hydroxy-3-phenylpropionyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11278]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-2002]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680322 70680322] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71294 71294] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06362 C06362] |
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: common name=3-hydroxy-3-phenylpropanoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J}} | ||
| + | {{#set: molecular weight=911.663 }} | ||
| + | {{#set: common name=hydroxycinnamoyl-CoA (ambiguous)|β-hydroxyphenyl-propionyl-CoA|3-hydroxy-3-phenylpropionyl-coenzyme A|3-hydroxy-3-phenylpropionyl-CoA}} | ||
| + | {{#set: consumed by=RXN-11278}} | ||
| + | {{#set: produced by=RXN-2002}} | ||
Revision as of 16:09, 23 May 2018
Contents
Metabolite CPD-513
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- common name:
- 3-hydroxy-3-phenylpropanoyl-CoA
- inchi key:
- InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J
- molecular weight:
- 911.663
- Synonym(s):
- hydroxycinnamoyl-CoA (ambiguous)
- β-hydroxyphenyl-propionyl-CoA
- 3-hydroxy-3-phenylpropionyl-coenzyme A
- 3-hydroxy-3-phenylpropionyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
