Difference between revisions of "CPD-4617"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N |
* common name: | * common name: | ||
− | ** | + | ** dihydrozeatin-O-glucoside |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 383.403 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-4726]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448] |
− | * | + | * HMDB : HMDB12214 |
− | + | {{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}} | |
− | + | {{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}} | |
− | {{#set: smiles= | + | {{#set: common name=dihydrozeatin-O-glucoside}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=383.403 }} |
− | {{#set: common name= | + | {{#set: produced by=RXN-4726}} |
− | {{#set: molecular weight= | + | |
− | + | ||
− | {{#set: produced by= | + |
Revision as of 16:10, 23 May 2018
Contents
Metabolite CPD-4617
- smiles:
- CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
- inchi key:
- InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
- common name:
- dihydrozeatin-O-glucoside
- molecular weight:
- 383.403
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links