Difference between revisions of "RXN-14285"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14285 RXN-14285] == * direction: ** LEFT-TO-RIGHT * common name: ** Starch phosphorylase * ec n...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14285 RXN-14285] ==
−
* smiles:
+
* direction:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
+
 
* common name:
 
* common name:
−
** episterol
+
** Starch phosphorylase
−
* molecular weight:
+
* ec number:
−
** 398.671   
+
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN3O-218]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Pi]][c] '''+''' 1 [[MALTOHEXAOSE]][c] '''=>''' 1 [[GLC-1-P]][c] '''+''' 1 [[MALTOPENTAOSE]][c]
−
* [[RXN3O-203]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 phosphate[c] '''+''' 1 maltohexaose[c] '''=>''' 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 maltopentaose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008988001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008988001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
+
{{#set: common name=Starch phosphorylase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.4.1.1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
+
{{#set: gene associated=CHC_T00008988001_1|CHC_T00008988001}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
+
{{#set: reconstruction category=orthology|annotation}}
−
* HMDB : HMDB06847
+
{{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
+
−
{{#set: common name=episterol}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: consumed by=RXN3O-218}}
+
−
{{#set: produced by=RXN3O-203}}
+

Revision as of 16:13, 23 May 2018

Reaction RXN-14285

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Starch phosphorylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 phosphate[c] + 1 maltohexaose[c] => 1 α-D-glucopyranose 1-phosphate[c] + 1 maltopentaose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-14285&oldid=16547"