Difference between revisions of "CHC T00008362001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
(Created page with "Category:Gene == Gene CHC_T00008362001 == * left end position: ** 56157 * transcription direction: ** NEGATIVE * right end position: ** 58934 * centisome position: ** 91.7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
+
== Gene CHC_T00008362001 ==
−
* smiles:
+
* left end position:
−
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
** 56157
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** tetrahydrogeranylgeranyl diphosphate
+
** 58934
−
* molecular weight:
+
* centisome position:
−
** 451.456    
+
** 91.722336    
 
* Synonym(s):
 
* Synonym(s):
−
** tetrahydroGGPP
 
−
** tetrahydrogeranylgeranyl pyrophosphate
 
−
** tetrahydrogeranylgeranyl-PP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN-7659]]
+
*** Assignment: automated-name-match
−
* [[RXN-7660]]
+
* Reaction: [[RXN0-4961]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=56157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: right end position=58934}}
−
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
+
{{#set: centisome position=91.722336   }}
−
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN|RXN0-4961}}
−
{{#set: molecular weight=451.456   }}
+
−
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
+
−
{{#set: consumed or produced by=RXN-7659|RXN-7660}}
+

Latest revision as of 16:15, 23 May 2018

Gene CHC_T00008362001

  • left end position:
    • 56157
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 58934
  • centisome position:
    • 91.722336
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008362001&oldid=16611"