Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008502001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == |
+ | * smiles: | ||
+ | ** C(C(COP(OCC(CO)O)([O-])=O)O)O | ||
+ | * inchi key: | ||
+ | ** InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** glycerophosphoglycerol | ||
+ | * molecular weight: | ||
+ | ** 245.146 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** diglycerol phosphate | ||
+ | ** bis(2,3-dihydroxypropyl) phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-14073]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202983 25202983] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61933 61933] | ||
+ | * BIGG : g3pg | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03274 C03274] | ||
+ | {{#set: smiles=C(C(COP(OCC(CO)O)([O-])=O)O)O}} | ||
+ | {{#set: inchi key=InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=glycerophosphoglycerol}} | ||
+ | {{#set: molecular weight=245.146 }} | ||
+ | {{#set: common name=diglycerol phosphate|bis(2,3-dihydroxypropyl) phosphate}} | ||
+ | {{#set: consumed by=RXN-14073}} |
Revision as of 17:16, 23 May 2018
Contents
Metabolite GLYCEROPHOSPHOGLYCEROL
- smiles:
- C(C(COP(OCC(CO)O)([O-])=O)O)O
- inchi key:
- InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M
- common name:
- glycerophosphoglycerol
- molecular weight:
- 245.146
- Synonym(s):
- diglycerol phosphate
- bis(2,3-dihydroxypropyl) phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(COP(OCC(CO)O)([O-])=O)O)O" cannot be used as a page name in this wiki.