Difference between revisions of "PWY-2723"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2723 PWY-2723] ==
* smiles:
+
* taxonomic range:
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
** magnesium-protoporphyrin IX 13-monomethyl ester
+
** trehalose degradation V
* molecular weight:
+
** 597.975   
+
 
* Synonym(s):
 
* Synonym(s):
** Mg-protoporphyrin monomethyl ester
 
** magnesium protoporphyrin monomethyl ester
 
** MgPMME
 
** magnesium-protoporphyrin IX 13-methyl ester
 
** MgP monomethyl ester
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-13191]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-5282]]
+
* [[GLUCOKIN-RXN]]
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
*** [[CHC_T00001373001_1]]
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008779001_1]]
 +
*** [[CHC_T00008779001]]
 +
*** [[CHC_T00003000001_1]]
 +
*** [[CHC_T00005896001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-4441 RXN-4441]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
+
{{#set: common name=trehalose degradation V}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=67.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: molecular weight=597.975    }}
+
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
+
{{#set: consumed by=RXN-13191|RXN-5282}}
+
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+

Revision as of 16:16, 23 May 2018

Pathway PWY-2723

  • taxonomic range:
  • common name:
    • trehalose degradation V
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links