Difference between revisions of "RXN-14249"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14249 RXN-14249] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14249 RXN-14249] ==
* smiles:
+
* direction:
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1.103 EC-1.1.1.103]
* common name:
+
** porifersta-5,7-dienol
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
** 24S-ethylcholesta-5,7-dien-3β-ol
 
** 7-dehydroclionasterol
 
** moonisterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-13892]]
+
** 1 [[THR]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[AMINO-ACETONE]][c] '''+''' 1 [[NADH]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-threonine[c] '''+''' 1 NAD+[c] '''=>''' 1 CO2[c] '''+''' 1 aminoacetone[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00007340001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 24057-73-6
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.103}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16058079 16058079]
+
{{#set: gene associated=CHC_T00007340001_1}}
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=porifersta-5,7-dienol}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
{{#set: molecular weight=412.698    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=24S-ethylcholesta-5,7-dien-3β-ol|7-dehydroclionasterol|moonisterol}}
+
{{#set: produced by=RXN-13892}}
+

Latest revision as of 16:18, 23 May 2018

Reaction RXN-14249

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-threonine[c] + 1 NAD+[c] => 1 CO2[c] + 1 aminoacetone[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links