Difference between revisions of "EPISTEROL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heme-b Heme-b] == * common name: ** heme b * Synonym(s): == Reaction(s) known to consume the c...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heme-b Heme-b] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
 +
* smiles:
 +
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
 
* common name:
 
* common name:
** heme b
+
** episterol
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN3O-218]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN3O-203]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[HEMEOSYN-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=heme b}}
+
* PUBCHEM:
{{#set: consumed or produced by=HEMEOSYN-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
 +
* HMDB : HMDB06847
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
 +
{{#set: common name=episterol}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: consumed by=RXN3O-218}}
 +
{{#set: produced by=RXN3O-203}}

Revision as of 16:19, 23 May 2018

Metabolite EPISTEROL

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
  • inchi key:
    • InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
  • common name:
    • episterol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))" cannot be used as a page name in this wiki.