Difference between revisions of "CPD-10269"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00005161001_1 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** pantograph-a.taliana * ATPSYN-RXN ** pantograph-[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == |
+ | * smiles: | ||
+ | ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J | ||
+ | * common name: | ||
+ | ** palmitoleoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 999.899 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 16:1-delta9-CoA | ||
+ | ** 9z-hexadecenoyl-CoA | ||
+ | ** cis-9-hexadecenoyl-CoA | ||
+ | ** palmitoleoyl coenzyme A | ||
+ | ** (9Z)-hexadec-9-enoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-17019]] |
− | + | * [[RXN-17008]] | |
− | * [[ | + | * [[RXN-17009]] |
− | + | * [[RXN-10662]] | |
− | == | + | * [[RXN-17788]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
+ | * [[RXN0-7248]] | ||
+ | * [[RXN-17787]] | ||
+ | * [[RXN-10664]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244393 25244393] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540] | ||
+ | * METABOLIGHTS : MTBLC61540 | ||
+ | {{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}} | ||
+ | {{#set: common name=palmitoleoyl-CoA}} | ||
+ | {{#set: molecular weight=999.899 }} | ||
+ | {{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-17019|RXN-17008|RXN-17009|RXN-10662|RXN-17788}} | ||
+ | {{#set: produced by=RXN0-7248|RXN-17787|RXN-10664}} |
Revision as of 17:21, 23 May 2018
Contents
Metabolite CPD-10269
- smiles:
- CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
- common name:
- palmitoleoyl-CoA
- molecular weight:
- 999.899
- Synonym(s):
- 16:1-delta9-CoA
- 9z-hexadecenoyl-CoA
- cis-9-hexadecenoyl-CoA
- palmitoleoyl coenzyme A
- (9Z)-hexadec-9-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.