Difference between revisions of "RIBOSYN2-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17271 CPD-17271] == * smiles: ** CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)CO)=O * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17271 CPD-17271] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)CO)=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VYQDALBEQRZDPL-DHUJRADRSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 1-stearoyl-2-palmitoyl-glycerol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 596.973 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-16030]] |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3246945 3246945] |
| − | + | {{#set: smiles=CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)CO)=O}} | |
| − | + | {{#set: inchi key=InChIKey=VYQDALBEQRZDPL-DHUJRADRSA-N}} | |
| − | + | {{#set: common name=1-stearoyl-2-palmitoyl-glycerol}} | |
| − | + | {{#set: molecular weight=596.973 }} | |
| − | + | {{#set: consumed by=RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.}} | |
| − | + | {{#set: consumed or produced by=RXN-16030}} | |
| − | + | ||
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: consumed by= | + | |
| − | + | ||
| − | {{#set: consumed or produced by= | + | |
Revision as of 10:53, 18 January 2018
Contents
Metabolite CPD-17271
- smiles:
- CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)CO)=O
- inchi key:
- InChIKey=VYQDALBEQRZDPL-DHUJRADRSA-N
- common name:
- 1-stearoyl-2-palmitoyl-glycerol
- molecular weight:
- 596.973
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
