Difference between revisions of "P3I"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I |
* common name: | * common name: | ||
| − | ** | + | ** PPPi |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 252.915 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** inorganic triphosphate |
| − | ** | + | ** tripolyphosphate |
| + | ** triphosphate | ||
| + | ** inorganic open chain tripolyphosphate | ||
| + | ** P3,i | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[BTUR2-RXN]] |
| + | * [[R344-RXN]] | ||
| + | * [[RXN0-5507]] | ||
| + | * [[COBALADENOSYLTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * CAS : 14127-68-5 | ||
| + | * METABOLIGHTS : MTBLC18036 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3440921 3440921] |
| + | * HMDB : HMDB03379 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00536 C00536] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.2683694.html 2683694] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18036 18036] |
| − | {{#set: smiles= | + | * BIGG : pppi |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=[O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I}} |
| − | {{#set: molecular weight= | + | {{#set: common name=PPPi}} |
| − | {{#set: common name= | + | {{#set: molecular weight=252.915 }} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=inorganic triphosphate|tripolyphosphate|triphosphate|inorganic open chain tripolyphosphate|P3,i}} |
| − | + | {{#set: produced by=BTUR2-RXN|R344-RXN|RXN0-5507|COBALADENOSYLTRANS-RXN}} | |
Revision as of 16:22, 23 May 2018
Contents
Metabolite P3I
- smiles:
- [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O
- inchi key:
- InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I
- common name:
- PPPi
- molecular weight:
- 252.915
- Synonym(s):
- inorganic triphosphate
- tripolyphosphate
- triphosphate
- inorganic open chain tripolyphosphate
- P3,i
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 14127-68-5
- METABOLIGHTS : MTBLC18036
- PUBCHEM:
- HMDB : HMDB03379
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : pppi
"O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O" cannot be used as a page name in this wiki.
