Difference between revisions of "DIHYDRONEOPTERIN-P"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008260001_1 == * Synonym(s): == Reactions associated == * GLUTAMATE-N-ACETYLTRANSFERASE-RXN ** pantograph-galdieria.sulphuraria *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == |
+ | * smiles: | ||
+ | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L | ||
+ | * common name: | ||
+ | ** 7,8-dihydroneopterin 3'-phosphate | ||
+ | * molecular weight: | ||
+ | ** 333.197 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** dihydroneopterin 3'-monophosphate | ||
+ | ** dihydroneopterin-P | ||
+ | ** 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate | ||
+ | ** dihydroneopterin 3'-phosphate | ||
+ | ** 7,8-dihydro-D-neopterin 3'-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05925 C05925] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58762 58762] | ||
+ | * BIGG : dhpmp | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245170 25245170] | ||
+ | * HMDB : HMDB06824 | ||
+ | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))}} | ||
+ | {{#set: inchi key=InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L}} | ||
+ | {{#set: common name=7,8-dihydroneopterin 3'-phosphate}} | ||
+ | {{#set: molecular weight=333.197 }} | ||
+ | {{#set: common name=dihydroneopterin 3'-monophosphate|dihydroneopterin-P|2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate|dihydroneopterin 3'-phosphate|7,8-dihydro-D-neopterin 3'-phosphate}} | ||
+ | {{#set: consumed by=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN}} | ||
+ | {{#set: produced by=H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} |
Revision as of 17:23, 23 May 2018
Contents
Metabolite DIHYDRONEOPTERIN-P
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))
- inchi key:
- InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L
- common name:
- 7,8-dihydroneopterin 3'-phosphate
- molecular weight:
- 333.197
- Synonym(s):
- dihydroneopterin 3'-monophosphate
- dihydroneopterin-P
- 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate
- dihydroneopterin 3'-phosphate
- 7,8-dihydro-D-neopterin 3'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))" cannot be used as a page name in this wiki.