Difference between revisions of "CHC T00008037001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene CHC_T00008037001_1 == * Synonym(s): == Reactions associated == * Reaction: FRUCTOKINASE-RXN ** Source: orthology-galdieria.sulphuraria == Pa...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00008037001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[FRUCTOKINASE-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
| − | == | + | == Pathways associated == |
| + | * [[PWY-5384]] | ||
| + | * [[PWY-621]] | ||
| + | * [[SUCUTIL-PWY]] | ||
| + | * [[SUCROSEUTIL2-PWY]] | ||
| + | * [[PWY-4101]] | ||
| + | * [[PWY-6531]] | ||
| + | * [[PWY-3801]] | ||
| + | * [[P122-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=FRUCTOKINASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-5384|PWY-621|SUCUTIL-PWY|SUCROSEUTIL2-PWY|PWY-4101|PWY-6531|PWY-3801|P122-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:24, 23 May 2018
Gene CHC_T00008037001_1
- Synonym(s):
Reactions associated
- Reaction: FRUCTOKINASE-RXN
- Source: orthology-galdieria.sulphuraria
