Difference between revisions of "GALACTURIDYLYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTURIDYLYLTRANS-RXN GALACTURIDYLYLTRANS-RXN] == * direction: ** REVERSIBLE * ec number: ** [htt...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTURIDYLYLTRANS-RXN GALACTURIDYLYLTRANS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.12 EC-2.7.7.12] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[GALACTOSE-1P]][c] '''+''' 1 [[CPD-12575]][c] '''<=>''' 1 [[GLC-1-P]][c] '''+''' 1 [[CPD-14553]][c] |
− | == | + | * With common name(s): |
+ | ** 1 α-D-galactose 1-phosphate[c] '''+''' 1 UDP-α-D-glucose[c] '''<=>''' 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 UDP-α-D-galactose[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00010193001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6317]], D-galactose degradation I (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY66-422]], D-galactose degradation V (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-422 PWY66-422] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13989 13989] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00955 R00955] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P43424 P43424] |
− | * | + | ** [http://www.uniprot.org/uniprot/P31764 P31764] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P07902 P07902] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08431 P08431] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P09148 P09148] |
− | * | + | ** [http://www.uniprot.org/uniprot/P13212 P13212] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P09580 P09580] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.7.12}} |
− | {{#set: | + | {{#set: gene associated=CHC_T00010193001_1}} |
− | {{#set: | + | {{#set: in pathway=PWY-6317|PWY66-422|PWY-6527}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
+ | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 17:25, 23 May 2018
Contents
Reaction GALACTURIDYLYLTRANS-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GALACTOSE-1P[c] + 1 CPD-12575[c] <=> 1 GLC-1-P[c] + 1 CPD-14553[c]
- With common name(s):
- 1 α-D-galactose 1-phosphate[c] + 1 UDP-α-D-glucose[c] <=> 1 α-D-glucopyranose 1-phosphate[c] + 1 UDP-α-D-galactose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00010193001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-6317, D-galactose degradation I (Leloir pathway): PWY-6317
- 5 reactions found over 5 reactions in the full pathway
- PWY66-422, D-galactose degradation V (Leloir pathway): PWY66-422
- 5 reactions found over 5 reactions in the full pathway
- PWY-6527, stachyose degradation: PWY-6527
- 7 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links