Difference between revisions of "FORMYLTHFGLUSYNTH-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFGLUSYNTH-RXN FORMYLTHFGLUSYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFGLUSYNTH-RXN FORMYLTHFGLUSYNTH-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/6.3.2.17 EC-6.3.2.17] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[Pi]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 L-glutamate[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 phosphate[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | == | + | Genes have been associated with this reaction based on different elements listed below. |
| + | * Gene: [[CHC_T00000400001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-6.3.2.17}} | |
| − | + | {{#set: gene associated=CHC_T00000400001_1}} | |
| − | + | {{#set: in pathway=PWY-2161}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:25, 23 May 2018
Contents
Reaction FORMYLTHFGLUSYNTH-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FORMYL-THF-GLU-N[c] + 1 GLT[c] + 1 ATP[c] => 1 ADP[c] + 1 FORMYL-THF-GLU-N[c] + 1 Pi[c]
- With common name(s):
- 1 an N10-formyl-tetrahydrofolate[c] + 1 L-glutamate[c] + 1 ATP[c] => 1 ADP[c] + 1 an N10-formyl-tetrahydrofolate[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00000400001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
