Difference between revisions of "THZ-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 221.167 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole |
| + | ** 4-methyl-5-(2-phosphoethyl)-thiazole | ||
| + | ** THZ-P | ||
| + | ** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate | ||
| + | ** HET-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[THI-P-SYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THIAZOLSYN3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296] |
| − | {{#set: common name= | + | * BIGG : 4mpetz |
| − | {{#set: molecular weight= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327] |
| − | {{#set: | + | {{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}} |
| + | {{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}} | ||
| + | {{#set: molecular weight=221.167 }} | ||
| + | {{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}} | ||
| + | {{#set: consumed by=THI-P-SYN-RXN}} | ||
| + | {{#set: produced by=THIAZOLSYN3-RXN}} | ||
Revision as of 16:28, 23 May 2018
Contents
Metabolite THZ-P
- smiles:
- CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
- inchi key:
- InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
- common name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- molecular weight:
- 221.167
- Synonym(s):
- 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
- 4-methyl-5-(2-phosphoethyl)-thiazole
- THZ-P
- 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
- HET-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.
