Difference between revisions of "EDTA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9548 RXN-9548] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9548 RXN-9548] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.1.2.14 EC-3.1.2.14]
+
** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
 +
* common name:
 +
** EDTA
 +
* molecular weight:
 +
** 290.229   
 
* Synonym(s):
 
* Synonym(s):
 +
** ethylenediaminetetraacetic acid
 +
** ethylenediaminetetraacetate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[TransportSeed_EDTA]]
** 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[STEARIC_ACID]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[TransportSeed_EDTA]]
** 1 a stearoyl-[acp][c] '''+''' 1 H2O[c] '''=>''' 1 stearate[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[ExchangeSeed_EDTA]]
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
+
** '''6''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[gap-filling]]:
+
** [[meneco]]:
+
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-3.1.2.14}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827]
{{#set: in pathway=PWY-5989}}
+
* CHEBI:
{{#set: reconstruction category=gap-filling}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191]
{{#set: reconstruction tool=meneco}}
+
* LIGAND-CPD:
{{#set: reconstruction source=added for gapfilling}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284]
 +
* HMDB : HMDB15109
 +
{{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}}
 +
{{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}}
 +
{{#set: common name=EDTA}}
 +
{{#set: molecular weight=290.229    }}
 +
{{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}}
 +
{{#set: consumed by=TransportSeed_EDTA}}
 +
{{#set: produced by=TransportSeed_EDTA}}
 +
{{#set: reversible reaction associated=ExchangeSeed_EDTA}}

Revision as of 17:29, 23 May 2018

Metabolite EDTA

  • smiles:
    • C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
  • inchi key:
    • InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
  • common name:
    • EDTA
  • molecular weight:
    • 290.229
  • Synonym(s):
    • ethylenediaminetetraacetic acid
    • ethylenediaminetetraacetate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.