Difference between revisions of "CPD-9038"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18379 CPD-18379] == * smiles: ** CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] * inchi key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18379 CPD-18379] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FAZBDRGXCKPVJU-MRXNPFEDSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 1-myristoylglycerol 3-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 380.417 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-tetradecanoyl-sn-glycerol 3-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17019]] | ||
| + | * [[RXN-17020]] | ||
| + | * [[RXN-17022]] | ||
| + | * [[RXN-17021]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17017]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIPID_MAPS : LMGP10050007 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71296162 71296162] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72683 72683] |
| − | * | + | * BIGG : 1tdecg3p |
| − | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=FAZBDRGXCKPVJU-MRXNPFEDSA-L}} |
| − | {{#set: common name= | + | {{#set: common name=1-myristoylglycerol 3-phosphate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=380.417 }} |
| − | {{#set: common name= | + | {{#set: common name=1-tetradecanoyl-sn-glycerol 3-phosphate}} |
| − | {{#set: produced by=RXN- | + | {{#set: consumed by=RXN-17019|RXN-17020|RXN-17022|RXN-17021}} |
| + | {{#set: produced by=RXN-17017}} | ||
Revision as of 10:53, 18 January 2018
Contents
Metabolite CPD-18379
- smiles:
- CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=FAZBDRGXCKPVJU-MRXNPFEDSA-L
- common name:
- 1-myristoylglycerol 3-phosphate
- molecular weight:
- 380.417
- Synonym(s):
- 1-tetradecanoyl-sn-glycerol 3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
