Difference between revisions of "CPD1F-132"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-GALACTOSYLCERAMIDE A-GALACTOSYLCERAMIDE] == * common name: ** a β-D-galactosyl-N-acylsph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == |
+ | * smiles: | ||
+ | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** ent-kaur-16-en-19-oate |
+ | * molecular weight: | ||
+ | ** 301.448 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ent-kaurenoate |
+ | ** ent-kaurenoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.14.13.79-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7580]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIPID_MAPS : LMPR0104130004 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874] | ||
+ | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}} | ||
+ | {{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}} | ||
+ | {{#set: common name=ent-kaur-16-en-19-oate}} | ||
+ | {{#set: molecular weight=301.448 }} | ||
+ | {{#set: common name=ent-kaurenoate|ent-kaurenoic acid}} | ||
+ | {{#set: consumed by=1.14.13.79-RXN}} | ||
+ | {{#set: produced by=RXN-7580}} |
Revision as of 17:31, 23 May 2018
Contents
Metabolite CPD1F-132
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
- inchi key:
- InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
- common name:
- ent-kaur-16-en-19-oate
- molecular weight:
- 301.448
- Synonym(s):
- ent-kaurenoate
- ent-kaurenoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.