Difference between revisions of "RXN-11575"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11575 RXN-11575] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11575 RXN-11575] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.2.3.49 EC-4.2.3.49]
+
** InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
 +
* common name:
 +
** 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
 +
* molecular weight:
 +
** 428.697   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-17]]
−
** 1 [[WATER]][c] '''+''' 1 [[FARNESYL-PP]][c] '''=>''' 1 [[CPD-8843]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-16]]
−
** 1 H2O[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''=>''' 1 (3R,6E)-nerolidol[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5434]], (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5434 PWY-5434]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27534 27534]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263319 44263319]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-4.2.3.49}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87046 87046]
−
{{#set: in pathway=PWY-5434}}
+
* HMDB : HMDB12168
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: inchi key=InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N}}
−
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: common name=4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: molecular weight=428.697    }}
 +
{{#set: consumed by=RXN66-17}}
 +
{{#set: produced by=RXN66-16}}

Revision as of 10:46, 18 January 2018

Metabolite CPD-8612

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
  • common name:
    • 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 428.697
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-11575&oldid=4508"