Difference between revisions of "RXN-9518"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18778 CPD-18778] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1) * comm...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9518 RXN-9518] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyhexanoyl-[acyl-carri...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9518 RXN-9518] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyhexanoyl-[acyl-carrier protein] reductase |
− | * | + | ** 3-oxoacyl-[acyl-carrier-protein] reductase |
− | ** | + | ** 3-oxoacyl-(acyl-carrier-protein) reductase |
− | * | + | ** beta-ketoacyl reductase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] | ||
+ | ** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[NADPH]][c] '''+''' 1 [[3-oxo-hexanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[R-3-hydroxyhexanoyl-ACPs]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 NADPH[c] '''+''' 1 a 3-oxo-hexanoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxyhexanoyl-[acp][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008557001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00008517001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008496001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00008477001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | * [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] | ||
+ | ** '''22''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: common name= | + | {{#set: common name=3-hydroxyhexanoyl-[acyl-carrier protein] reductase}} |
− | {{#set: | + | {{#set: common name=3-oxoacyl-[acyl-carrier-protein] reductase}} |
− | {{#set: | + | {{#set: common name=3-oxoacyl-(acyl-carrier-protein) reductase}} |
− | {{#set: | + | {{#set: common name=beta-ketoacyl reductase}} |
+ | {{#set: ec number=EC-2.3.1.86}} | ||
+ | {{#set: ec number=EC-2.3.1.85}} | ||
+ | {{#set: ec number=EC-1.1.1.100}} | ||
+ | {{#set: gene associated=CHC_T00008557001|CHC_T00008517001_1|CHC_T00008496001|CHC_T00008477001}} | ||
+ | {{#set: in pathway=PWY-5971|PWY-5994}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 17:33, 23 May 2018
Contents
Reaction RXN-9518
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxyhexanoyl-[acyl-carrier protein] reductase
- 3-oxoacyl-[acyl-carrier-protein] reductase
- 3-oxoacyl-(acyl-carrier-protein) reductase
- beta-ketoacyl reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 3-oxo-hexanoyl-ACPs[c] + 1 PROTON[c] => 1 NADP[c] + 1 R-3-hydroxyhexanoyl-ACPs[c]
- With common name(s):
- 1 NADPH[c] + 1 a 3-oxo-hexanoyl-[acp][c] + 1 H+[c] => 1 NADP+[c] + 1 a (3R)-3-hydroxyhexanoyl-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008557001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008517001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008496001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008477001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 31 reactions found over 31 reactions in the full pathway
- PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
- 22 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
"3-hydroxyhexanoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
"3-oxoacyl-[acyl-carrier-protein] reductase" cannot be used as a page name in this wiki.