Difference between revisions of "TRNA-URACIL-5--METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-URACIL-5--METHYLTRANSFERASE-RXN TRNA-URACIL-5--METHYLTRANSFERASE-RXN] == * direction: ** LEFT-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-URACIL-5--METHYLTRANSFERASE-RXN TRNA-URACIL-5--METHYLTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.1.1.35 EC-2.1.1.35] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Uracil-54-in-tRNA]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[tRNA-containing-5Me-uridine54]][c] '''+''' 1 [[PROTON]][c] |
− | * | + | * With common name(s): |
− | * [[ | + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 a uracil54 in tRNA[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 a 5-methyluracil54 in tRNA[c] '''+''' 1 H+[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008089001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00594 R00594] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P23003 P23003] |
− | * | + | ** [http://www.uniprot.org/uniprot/P31812 P31812] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PP92 Q9PP92] |
− | + | ** [http://www.uniprot.org/uniprot/Q9JT82 Q9JT82] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: ec number=EC-2.1.1.35}} | |
− | ** [http://www. | + | {{#set: gene associated=CHC_T00008089001_1}} |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:33, 23 May 2018
Contents
Reaction TRNA-URACIL-5--METHYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 Uracil-54-in-tRNA[c] => 1 ADENOSYL-HOMO-CYS[c] + 1 tRNA-containing-5Me-uridine54[c] + 1 PROTON[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 a uracil54 in tRNA[c] => 1 S-adenosyl-L-homocysteine[c] + 1 a 5-methyluracil54 in tRNA[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008089001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links